| Triethanolamine | |
|---|---|
 |
|
| IUPAC name | 2,2',2"-Nitrilotriethanol |
| Other names | Tris(2-hydroxyethyl)amine, 2,2',2"-Trihydroxy-triethylamine, Triethylolamine, Trolamine, TEA |
| Identifiers | |
| CAS number | |
| PubChem | |
| EINECS number | |
| KEGG | |
| ChEBI | |
| RTECS number | KL9275000 |
| SMILES | OCC[N](CCO)CCO |
| InChI | InChI=1/C6H15NO3/c8-4-1-7(2-5-9)3-6-10/h8-10H,1-6H2 |
| Properties | |
| Molecular formula | C6H15NO3 |
| Molar mass | 149.188 g/mol |
| Appearance | Pale yellow liquid, hygroscopic |
| Density | 1.126 g/cm3 |
| Melting point |
20.5°C (293.65 K) |
| Boiling point |
208 °C (20 hPa) |
| Solubility in water | Miscible |
| Hazards | |
| Main hazards | Irritant |
| NFPA 704 |
 1
2
0
|
| R-phrases | R36, R37, R38 |
| S-phrases | S26, S36 |
| Flash point | 179 °C |
| Autoignition temperature |
325 °C |
| Explosive limits | 3.6 - 7.2 % |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Triethanolamine, often abbreviated as TEA, is an organic chemical compound which is both a tertiary amine and a tri-alcohol. A tri-alcohol is a molecule with three hydroxyl groups. Like other amines, triethanolamine acts as a weak base due to the lone pair of electrons on the nitrogen atom. This ingredient is used as a pH balancer in cosmetic preparations in a variety of different products - ranging from skin lotion, eye gels, moisturizers, shampoos, shaving foams etc. As with any amines, it may have the potential to create nitrosamines, but with the low concentrations used in cosmetic products the chances of that happening is very slim and it is further theorized that nitrosamines cannot penetrate the skin. It is listed under Schedule 3, part B of the Chemical Weapons Convention as it can be used in the manufacture nitrogen mustards.
