| Pararosanilin | |
|---|---|
 Chloride counteranion not displayed |
|
| General | |
| Systematic name | Benzenamine, 4- [(4-aminophenyl) (4-imino-2,5-cyclohexadien-1-ylidene) methyl]-, monohydrochloride |
| Other names |
|
| Molecular formula | C19H18ClN3 |
| SMILES | [Cl-].Nc1ccc(cc1)C(c2ccc(N)cc2) =C3C=CC(=[NH2+])C=C3 |
| Molar mass | 323.82 g/mol |
| Appearance | Green crystalline solid |
| CAS number | [569-61-9] |
| Properties | |
| Density and phase | ? g/cm3, ? |
| Solubility in water | slightly soluble |
| Melting point | 268-270°C (541-543 K) dec. |
| Boiling point | ?°C (? K) |
| Acidity (pKa) | ? |
| Structure | |
| Crystal structure | ? |
| Dipole moment | ? D |
| Hazards | |
| MSDS | External MSDS] |
| Main hazards | ? |
| NFPA 704 |
 1
3
0
|
| Flash point | ?°C |
| R/S statement | R: ? S: ? |
| RTECS number | ? |
| Supplementary data page | |
| Structure and properties |
n, εr, etc. |
| Thermodynamic data |
Phase behaviour Solid, liquid, gas |
| Spectral data | UV, IR, NMR, MS |
| Related compounds | |
| Other anions | ? |
| Related ? | ? |
| Related compounds | ? |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Pararosaniline, Magenta 0, Basic Red 9, or C.I. 42500 is a magenta dye having chemical formula C19H18N3Cl. It is closely related to fuchsine, new fuchsine, and fuchsine acid. It makes the best Schiff's reagent.
