| Hexachloroacetone | |
|---|---|
| IUPAC name | 1,1,1,3,3,3-hexachloropropanone |
| Other names | perchloroacetone HCA |
| Identifiers | |
| CAS number | |
| SMILES | ClC(Cl)(Cl)C(=O)C(Cl)(Cl)Cl |
| Properties | |
| Molecular formula | C3Cl6O |
| Molar mass | 264.75 g/mol |
| Density | ? g/cm3 |
| Melting point |
-2 °C |
| Boiling point |
204 °C |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Hexachloroacetone is an organic compound with the formula CCl3-CO-CCl3. It is also called 1,1,1,3,3,3-hexachloropropanone. It is a colorless liquid that is slightly soluble in water. The main use of hexachloroacetone is as a pesticide. For the use of hexachloroacetone in the preparation of a novel insect repellant, see Perkow reaction.


