| Ergocalciferol | |
|---|---|
| IUPAC name | (3β,5Z,7E,22E)-9,10-secoergosta-5,7,10(19),22-tetraen-3-ol |
| Other names | Drisdol (Sanofi-Synthelabo) |
| Identifiers | |
| CAS number | |
| SMILES | CC(C)[C@@H](C)/C=C/[C@@H](C)[C@H]1CC[C@H]2/C (CCC[C@]12C)=C/C=C3/C[C@@H](O)CCC3=C |
| Properties | |
| Molecular formula | C28H44O |
| Molar mass | 396.65 g/mol |
| Melting point |
114-118 °C |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Ergocalciferol (Deltalin®, Eli Lilly and Company) is a form of Vitamin D, also called vitamin D2. It has the systematic name "(3β,5Z,7E,22E)-9,10-secoergosta-5,7,10(19),22-tetraen-3-ol". It is created from viosterol, which in turn is created when ultraviolet light activates ergosterol.
References
|
|
|
|---|---|
| fat soluble | A (Retinol, Beta-carotene, Tretinoin, Alpha-carotene) - D (Ergocalciferol, Cholecalciferol, Dihydrotachysterol, Calcitriol, Calcidiol) - E (Tocopherol, Tocotrienol) - K (Naphthoquinone, Phylloquinone/K1, Menatetrenone/K2) |
| water soluble: B vitamins | B1 (Thiamine, Sulbutiamine, Benfotiamine) - B2 (Riboflavin) - B3 (Niacin, Nicotinamide) - B5 (Pantothenic acid, Dexpanthenol, Pantethine) - B6 (Pyridoxine, Pyridoxal phosphate) - B7 (Biotin) - B9 (Folic acid) - B12 (Cyanocobalamin, Hydroxocobalamin, Methylcobalamin, Cobamamide) |
| water soluble: other | C (Ascorbic acid) - Choline |
|
|
|---|
| Adosterol - Cholecalciferol/Ergocalciferols - Cholesterol - Dihydrotachysterol - Fusidic acid - Lanosterol - Phytosterols - Solanine |


